C24H26N2O2S3 — CID 164834203
3,17-bis(2-methylbutyl)-7,10,13-trithia-3,17-diazapentacyclo[9.6.0.02,9.04,8.012,16]heptadeca-1(11),2(9),4(8),5,12(16),14-hexaene-6,14-dicarbaldehyde (PubChem CID 164834203) has the molecular formula C24H26N2O2S3 and a molecular weight of 470.69 g/mol. Its IUPAC name is 3,17-bis(2-methylbutyl)-7,10,13-trithia-3,17-diazapentacyclo[9.6.0.02,9.04,8.012,16]heptadeca-1(11),2(9),4(8),5,12(16),14-hexaene-6,14-dicarbaldehyde.
| Compound Name | 3,17-bis(2-methylbutyl)-7,10,13-trithia-3,17-diazapentacyclo[9.6.0.02,9.04,8.012,16]heptadeca-1(11),2(9),4(8),5,12(16),14-hexaene-6,14-dicarbaldehyde |
|---|---|
| PubChem CID | 164834203 |
| Molecular Formula | C24H26N2O2S3 |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 3,17-bis(2-methylbutyl)-7,10,13-trithia-3,17-diazapentacyclo[9.6.0.02,9.04,8.012,16]heptadeca-1(11),2(9),4(8),5,12(16),14-hexaene-6,14-dicarbaldehyde |
| SMILES | CCC(C)Cn1c2cc(C=O)sc2c2sc3c4sc(C=O)cc4n(CC(C)CC)c3c21 |
| InChI | InChI=1S/C24H26N2O2S3/c1-5-13(3)9-25-17-7-15(11-27)29-21(17)23-19(25)20-24(31-23)22-18(8-16(12-28)30-22)26(20)10-14(4)6-2/h7-8,11-14H,5-6,9-10H2,1-4H3 |
| InChIKey | PIVBDKAEHNQEMH-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|