C25H29F3N8O3S — CID 164834449
13-[2-(2-hydroxyethoxy)-4-(4-methylpiperazin-1-yl)anilino]-2,5-dimethyl-9-(2,2,2-trifluoroethyl)-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one (PubChem CID 164834449) has the molecular formula C25H29F3N8O3S and a molecular weight of 578.62 g/mol. Its IUPAC name is 13-[2-(2-hydroxyethoxy)-4-(4-methylpiperazin-1-yl)anilino]-2,5-dimethyl-9-(2,2,2-trifluoroethyl)-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one.
| Compound Name | 13-[2-(2-hydroxyethoxy)-4-(4-methylpiperazin-1-yl)anilino]-2,5-dimethyl-9-(2,2,2-trifluoroethyl)-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one |
|---|---|
| PubChem CID | 164834449 |
| Molecular Formula | C25H29F3N8O3S |
| Molecular Weight | 578.62 g/mol |
| Exact Mass | 578.20 |
| IUPAC Name | 13-[2-(2-hydroxyethoxy)-4-(4-methylpiperazin-1-yl)anilino]-2,5-dimethyl-9-(2,2,2-trifluoroethyl)-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one |
| SMILES | Cc1nc2c(s1)N(C)c1nc(Nc3ccc(N4CCN(C)CC4)cc3OCCO)ncc1N(CC(F)(F)F)C2=O |
| InChI | InChI=1S/C25H29F3N8O3S/c1-15-30-20-22(38)36(14-25(26,27)28)18-13-29-24(32-21(18)34(3)23(20)40-15)31-17-5-4-16(12-19(17)39-11-10-37)35-8-6-33(2)7-9-35/h4-5,12-13,37H,6-11,14H2,1-3H3,(H,29,31,32) |
| InChIKey | NTZWBRSLZVAKSI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 110.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.62 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|