C25H32N8O3S — CID 164834452
9-ethyl-13-[2-(2-hydroxyethoxy)-4-(4-methylpiperazin-1-yl)anilino]-2,5-dimethyl-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one (PubChem CID 164834452) has the molecular formula C25H32N8O3S and a molecular weight of 524.65 g/mol. Its IUPAC name is 9-ethyl-13-[2-(2-hydroxyethoxy)-4-(4-methylpiperazin-1-yl)anilino]-2,5-dimethyl-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one.
| Compound Name | 9-ethyl-13-[2-(2-hydroxyethoxy)-4-(4-methylpiperazin-1-yl)anilino]-2,5-dimethyl-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one |
|---|---|
| PubChem CID | 164834452 |
| Molecular Formula | C25H32N8O3S |
| Molecular Weight | 524.65 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | 9-ethyl-13-[2-(2-hydroxyethoxy)-4-(4-methylpiperazin-1-yl)anilino]-2,5-dimethyl-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one |
| SMILES | CCN1C(=O)c2nc(C)sc2N(C)c2nc(Nc3ccc(N4CCN(C)CC4)cc3OCCO)ncc21 |
| InChI | InChI=1S/C25H32N8O3S/c1-5-33-19-15-26-25(29-22(19)31(4)24-21(23(33)35)27-16(2)37-24)28-18-7-6-17(14-20(18)36-13-12-34)32-10-8-30(3)9-11-32/h6-7,14-15,34H,5,8-13H2,1-4H3,(H,26,28,29) |
| InChIKey | DDGMWHNOJIMDOC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 110.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.65 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|