C50H52B2N2 — CID 164836281
6,19-ditert-butyl-9,22-bis(2,4,6-trimethylphenyl)-2,15-diaza-9,22-diboraheptacyclo[13.11.1.12,10.03,8.016,21.023,27.014,28]octacosa-1(26),3(8),4,6,10(28),11,13,16(21),17,19,23(27),24-dodecaene (PubChem CID 164836281) has the molecular formula C50H52B2N2 and a molecular weight of 702.60 g/mol. Its IUPAC name is 6,19-ditert-butyl-9,22-bis(2,4,6-trimethylphenyl)-2,15-diaza-9,22-diboraheptacyclo[13.11.1.12,10.03,8.016,21.023,27.014,28]octacosa-1(26),3(8),4,6,10(28),11,13,16(21),17,19,23(27),24-dodecaene.
| Compound Name | 6,19-ditert-butyl-9,22-bis(2,4,6-trimethylphenyl)-2,15-diaza-9,22-diboraheptacyclo[13.11.1.12,10.03,8.016,21.023,27.014,28]octacosa-1(26),3(8),4,6,10(28),11,13,16(21),17,19,23(27),24-dodecaene |
|---|---|
| PubChem CID | 164836281 |
| Molecular Formula | C50H52B2N2 |
| Molecular Weight | 702.60 g/mol |
| Exact Mass | 702.43 |
| IUPAC Name | 6,19-ditert-butyl-9,22-bis(2,4,6-trimethylphenyl)-2,15-diaza-9,22-diboraheptacyclo[13.11.1.12,10.03,8.016,21.023,27.014,28]octacosa-1(26),3(8),4,6,10(28),11,13,16(21),17,19,23(27),24-dodecaene |
| SMILES | Cc1cc(C)c(B2c3cc(C(C)(C)C)ccc3N3c4cccc5c4N(c4ccc(C(C)(C)C)cc4B5c4c(C)cc(C)cc4C)c4cccc2c43)c(C)c1 |
| InChI | InChI=1S/C50H52B2N2/c1-29-23-31(3)45(32(4)24-29)51-37-15-13-17-43-47(37)53(41-21-19-35(27-39(41)51)49(7,8)9)44-18-14-16-38-48(44)54(43)42-22-20-36(50(10,11)12)28-40(42)52(38)46-33(5)25-30(2)26-34(46)6/h13-28H,1-12H3 |
| InChIKey | YFKBHNCOAICAQM-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.60 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|