C15H20FN3 — CID 164836679
1-(2-fluoro-4-isocyanophenyl)-4-(2-methylpropyl)piperazine (PubChem CID 164836679) has the molecular formula C15H20FN3 and a molecular weight of 261.34 g/mol. Its IUPAC name is 1-(2-fluoro-4-isocyanophenyl)-4-(2-methylpropyl)piperazine.
| Compound Name | 1-(2-fluoro-4-isocyanophenyl)-4-(2-methylpropyl)piperazine |
|---|---|
| PubChem CID | 164836679 |
| Molecular Formula | C15H20FN3 |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 1-(2-fluoro-4-isocyanophenyl)-4-(2-methylpropyl)piperazine |
| SMILES | [C-]#[N+]c1ccc(N2CCN(CC(C)C)CC2)c(F)c1 |
| InChI | InChI=1S/C15H20FN3/c1-12(2)11-18-6-8-19(9-7-18)15-5-4-13(17-3)10-14(15)16/h4-5,10,12H,6-9,11H2,1-2H3 |
| InChIKey | RTFUIDVRPGJGNK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 10.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|