About 5-fluoro-3,6-di(propan-2-yl)pyridin-2-amine
5-fluoro-3,6-di(propan-2-yl)pyridin-2-amine (PubChem CID 164837315) has the molecular formula C11H17FN2
and a molecular weight of 196.27 g/mol. Its IUPAC name is 5-fluoro-3,6-di(propan-2-yl)pyridin-2-amine.
Molecular Properties
| Compound Name | 5-fluoro-3,6-di(propan-2-yl)pyridin-2-amine |
| PubChem CID | 164837315 |
| Molecular Formula | C11H17FN2 |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | 5-fluoro-3,6-di(propan-2-yl)pyridin-2-amine |
| SMILES | CC(C)c1cc(F)c(C(C)C)nc1N |
| InChI | InChI=1S/C11H17FN2/c1-6(2)8-5-9(12)10(7(3)4)14-11(8)13/h5-7H,1-4H3,(H2,13,14) |
| InChIKey | CQHMYBUOBPFPLI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-3,6-di(propan-2-yl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3,6-di(propan-2-yl)pyridin-2-amine?
The IUPAC name of 5-fluoro-3,6-di(propan-2-yl)pyridin-2-amine (CID 164837315) is 5-fluoro-3,6-di(propan-2-yl)pyridin-2-amine.
What is the SMILES notation for 5-fluoro-3,6-di(propan-2-yl)pyridin-2-amine?
The canonical SMILES for 5-fluoro-3,6-di(propan-2-yl)pyridin-2-amine is CC(C)c1cc(F)c(C(C)C)nc1N.
What is the InChIKey of 5-fluoro-3,6-di(propan-2-yl)pyridin-2-amine?
The InChIKey is CQHMYBUOBPFPLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17FN2/c1-6(2)8-5-9(12)10(7(3)4)14-11(8)13/h5-7H,1-4H3,(H2,13,14).
What are the key properties of 5-fluoro-3,6-di(propan-2-yl)pyridin-2-amine?
5-fluoro-3,6-di(propan-2-yl)pyridin-2-amine has a molecular weight of 196.27 g/mol, XLogP of 3.05, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3,6-di(propan-2-yl)pyridin-2-amine is sourced from PubChem (CID 164837315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).