C13H24BN5O7S — CID 164837777
(3R,4S)-3-amino-1-[2-aminoethyl(1,3-oxazol-2-yl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid (PubChem CID 164837777) has the molecular formula C13H24BN5O7S and a molecular weight of 405.24 g/mol. Its IUPAC name is (3R,4S)-3-amino-1-[2-aminoethyl(1,3-oxazol-2-yl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4S)-3-amino-1-[2-aminoethyl(1,3-oxazol-2-yl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 164837777 |
| Molecular Formula | C13H24BN5O7S |
| Molecular Weight | 405.24 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | (3R,4S)-3-amino-1-[2-aminoethyl(1,3-oxazol-2-yl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
| SMILES | NCCN(c1ncco1)S(=O)(=O)N1C[C@H](CCCB(O)O)[C@](N)(C(=O)O)C1 |
| InChI | InChI=1S/C13H24BN5O7S/c15-4-6-19(12-17-5-7-26-12)27(24,25)18-8-10(2-1-3-14(22)23)13(16,9-18)11(20)21/h5,7,10,22-23H,1-4,6,8-9,15-16H2,(H,20,21)/t10-,13-/m0/s1 |
| InChIKey | FZQLTJUPOJRYAA-GWCFXTLKSA-N |
| XLogP | -2.35 |
| TPSA | 196.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.24 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|