C15H26BN5O8S — CID 164837924
(3R,4S)-3-amino-1-[(4-aminooxolan-3-yl)-(1,3-oxazol-2-yl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid (PubChem CID 164837924) has the molecular formula C15H26BN5O8S and a molecular weight of 447.28 g/mol. Its IUPAC name is (3R,4S)-3-amino-1-[(4-aminooxolan-3-yl)-(1,3-oxazol-2-yl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4S)-3-amino-1-[(4-aminooxolan-3-yl)-(1,3-oxazol-2-yl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 164837924 |
| Molecular Formula | C15H26BN5O8S |
| Molecular Weight | 447.28 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | (3R,4S)-3-amino-1-[(4-aminooxolan-3-yl)-(1,3-oxazol-2-yl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
| SMILES | NC1COCC1N(c1ncco1)S(=O)(=O)N1C[C@H](CCCB(O)O)[C@](N)(C(=O)O)C1 |
| InChI | InChI=1S/C15H26BN5O8S/c17-11-7-28-8-12(11)21(14-19-4-5-29-14)30(26,27)20-6-10(2-1-3-16(24)25)15(18,9-20)13(22)23/h4-5,10-12,24-25H,1-3,6-9,17-18H2,(H,22,23)/t10-,11?,12?,15-/m0/s1 |
| InChIKey | PSRZKGFFYMGINK-QZLRTXKQSA-N |
| XLogP | -2.58 |
| TPSA | 205.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.28 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|