C45H27N3OPt — CID 164838236
5-[3-[[9-(5-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]benzene-2-id-1-yl]-4-azapentacyclo[12.7.1.02,7.08,13.018,22]docosa-1(21),2,4,6,8,10,12,14,16,18(22),19-undecaene;platinum(2+) (PubChem CID 164838236) has the molecular formula C45H27N3OPt and a molecular weight of 820.81 g/mol. Its IUPAC name is 5-[3-[[9-(5-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]benzene-2-id-1-yl]-4-azapentacyclo[12.7.1.02,7.08,13.018,22]docosa-1(21),2,4,6,8,10,12,14,16,18(22),19-undecaene;platinum(2+).
| Compound Name | 5-[3-[[9-(5-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]benzene-2-id-1-yl]-4-azapentacyclo[12.7.1.02,7.08,13.018,22]docosa-1(21),2,4,6,8,10,12,14,16,18(22),19-undecaene;platinum(2+) |
|---|---|
| PubChem CID | 164838236 |
| Molecular Formula | C45H27N3OPt |
| Molecular Weight | 820.81 g/mol |
| Exact Mass | 820.18 |
| IUPAC Name | 5-[3-[[9-(5-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]benzene-2-id-1-yl]-4-azapentacyclo[12.7.1.02,7.08,13.018,22]docosa-1(21),2,4,6,8,10,12,14,16,18(22),19-undecaene;platinum(2+) |
| SMILES | Cc1ccc(-n2c3[c-]c(Oc4[c-]c(-c5cc6c(cn5)-c5cccc7cccc(c57)-c5ccccc5-6)ccc4)ccc3c3ccccc32)nc1.[Pt+2] |
| InChI | InChI=1S/C45H27N3O.Pt/c1-28-19-22-44(47-26-28)48-42-18-5-4-15-35(42)36-21-20-32(24-43(36)48)49-31-12-6-11-30(23-31)41-25-39-34-14-3-2-13-33(34)37-16-7-9-29-10-8-17-38(45(29)37)40(39)27-46-41;/h2-22,25-27H,1H3;/q-2;+2 |
| InChIKey | BKPKYGCHUQUKQF-UHFFFAOYSA-N |
| XLogP | 11.41 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.81 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|