C11H10F3N2O3P — CID 164838816
(2-methylcinnolin-2-ium-4-yl)-(2,2,2-trifluoroethoxy)phosphinate (PubChem CID 164838816) has the molecular formula C11H10F3N2O3P and a molecular weight of 306.18 g/mol. Its IUPAC name is (2-methylcinnolin-2-ium-4-yl)-(2,2,2-trifluoroethoxy)phosphinate.
| Compound Name | (2-methylcinnolin-2-ium-4-yl)-(2,2,2-trifluoroethoxy)phosphinate |
|---|---|
| PubChem CID | 164838816 |
| Molecular Formula | C11H10F3N2O3P |
| Molecular Weight | 306.18 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | (2-methylcinnolin-2-ium-4-yl)-(2,2,2-trifluoroethoxy)phosphinate |
| SMILES | C[n+]1cc(P(=O)([O-])OCC(F)(F)F)c2ccccc2n1 |
| InChI | InChI=1S/C11H10F3N2O3P/c1-16-6-10(8-4-2-3-5-9(8)15-16)20(17,18)19-7-11(12,13)14/h2-6H,7H2,1H3 |
| InChIKey | ABEOHBIMEZMKIB-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 66.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.18 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|