C11H11F3N2O3P+ — CID 164838817
(2-methylcinnolin-2-ium-4-yl)-(2,2,2-trifluoroethoxy)phosphinic acid (PubChem CID 164838817) has the molecular formula C11H11F3N2O3P+ and a molecular weight of 307.19 g/mol. Its IUPAC name is (2-methylcinnolin-2-ium-4-yl)-(2,2,2-trifluoroethoxy)phosphinic acid.
| Compound Name | (2-methylcinnolin-2-ium-4-yl)-(2,2,2-trifluoroethoxy)phosphinic acid |
|---|---|
| PubChem CID | 164838817 |
| Molecular Formula | C11H11F3N2O3P+ |
| Molecular Weight | 307.19 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | (2-methylcinnolin-2-ium-4-yl)-(2,2,2-trifluoroethoxy)phosphinic acid |
| SMILES | C[n+]1cc(P(=O)(O)OCC(F)(F)F)c2ccccc2n1 |
| InChI | InChI=1S/C11H10F3N2O3P/c1-16-6-10(8-4-2-3-5-9(8)15-16)20(17,18)19-7-11(12,13)14/h2-6H,7H2,1H3/p+1 |
| InChIKey | ABEOHBIMEZMKIB-UHFFFAOYSA-O |
| XLogP | 1.45 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.19 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|