C14H17N2O4P — CID 164838822
(2-methylcinnolin-2-ium-4-yl)-(oxolan-2-ylmethoxy)phosphinate (PubChem CID 164838822) has the molecular formula C14H17N2O4P and a molecular weight of 308.27 g/mol. Its IUPAC name is (2-methylcinnolin-2-ium-4-yl)-(oxolan-2-ylmethoxy)phosphinate.
| Compound Name | (2-methylcinnolin-2-ium-4-yl)-(oxolan-2-ylmethoxy)phosphinate |
|---|---|
| PubChem CID | 164838822 |
| Molecular Formula | C14H17N2O4P |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | (2-methylcinnolin-2-ium-4-yl)-(oxolan-2-ylmethoxy)phosphinate |
| SMILES | C[n+]1cc(P(=O)([O-])OCC2CCCO2)c2ccccc2n1 |
| InChI | InChI=1S/C14H17N2O4P/c1-16-9-14(12-6-2-3-7-13(12)15-16)21(17,18)20-10-11-5-4-8-19-11/h2-3,6-7,9,11H,4-5,8,10H2,1H3 |
| InChIKey | FLXXMCCFHAMOAK-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 75.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|