C22H25N3O3 — CID 164840762
(1S,12S,15S)-7-(hydroxymethyl)-12-(2-methylprop-1-enyl)-10,13,19-triazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-3(11),4(9),5,7-tetraene-14,20-dione (PubChem CID 164840762) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is (1S,12S,15S)-7-(hydroxymethyl)-12-(2-methylprop-1-enyl)-10,13,19-triazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-3(11),4(9),5,7-tetraene-14,20-dione.
| Compound Name | (1S,12S,15S)-7-(hydroxymethyl)-12-(2-methylprop-1-enyl)-10,13,19-triazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-3(11),4(9),5,7-tetraene-14,20-dione |
|---|---|
| PubChem CID | 164840762 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | (1S,12S,15S)-7-(hydroxymethyl)-12-(2-methylprop-1-enyl)-10,13,19-triazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-3(11),4(9),5,7-tetraene-14,20-dione |
| SMILES | CC(C)=C[C@H]1c2[nH]c3cc(CO)ccc3c2C[C@H]2C(=O)N3CCC[C@H]3C(=O)N21 |
| InChI | InChI=1S/C22H25N3O3/c1-12(2)8-18-20-15(14-6-5-13(11-26)9-16(14)23-20)10-19-21(27)24-7-3-4-17(24)22(28)25(18)19/h5-6,8-9,17-19,23,26H,3-4,7,10-11H2,1-2H3/t17-,18-,19-/m0/s1 |
| InChIKey | SGGTVVPUUAZKGX-FHWLQOOXSA-N |
| XLogP | 2.43 |
| TPSA | 76.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|