C23H31BN3O3+ — CID 164841130
CID 164841130 (PubChem CID 164841130) has the molecular formula C23H31BN3O3+ and a molecular weight of 408.33 g/mol.
| Compound Name | CID 164841130 |
|---|---|
| PubChem CID | 164841130 |
| Molecular Formula | C23H31BN3O3+ |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | — |
| SMILES | [B][N+]12CCC(CC1)[C@H](OC(=O)N1CCc3ccccc3C1C1CCN(C)C(=O)C1)C2 |
| InChI | InChI=1S/C23H31BN3O3/c1-25-10-6-18(14-21(25)28)22-19-5-3-2-4-16(19)7-11-26(22)23(29)30-20-15-27(24)12-8-17(20)9-13-27/h2-5,17-18,20,22H,6-15H2,1H3/q+1/t17?,18?,20-,22?,27?/m1/s1 |
| InChIKey | ZDELQZRFBCYAFO-VMZYZNTKSA-N |
| XLogP | 2.28 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|