C12F16O — CID 164842487
1,2,3,4,5-pentafluoro-6-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]oxybenzene (PubChem CID 164842487) has the molecular formula C12F16O and a molecular weight of 464.10 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]oxybenzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]oxybenzene |
|---|---|
| PubChem CID | 164842487 |
| Molecular Formula | C12F16O |
| Molecular Weight | 464.10 g/mol |
| Exact Mass | 463.97 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]oxybenzene |
| SMILES | Fc1c(F)c(F)c(OC(=C(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C12F16O/c13-1-2(14)4(16)6(5(17)3(1)15)29-8(9(18,19)12(26,27)28)7(10(20,21)22)11(23,24)25 |
| InChIKey | VNPONBXPNPUCBI-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.10 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|