C18H14Cl2N4O2 — CID 164842631
(1aS,2S,7bR)-6-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-2-(hydroxymethyl)-1,1a,2,7b-tetrahydrocyclopropa[a]indolizin-4-one (PubChem CID 164842631) has the molecular formula C18H14Cl2N4O2 and a molecular weight of 389.24 g/mol. Its IUPAC name is (1aS,2S,7bR)-6-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-2-(hydroxymethyl)-1,1a,2,7b-tetrahydrocyclopropa[a]indolizin-4-one.
| Compound Name | (1aS,2S,7bR)-6-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-2-(hydroxymethyl)-1,1a,2,7b-tetrahydrocyclopropa[a]indolizin-4-one |
|---|---|
| PubChem CID | 164842631 |
| Molecular Formula | C18H14Cl2N4O2 |
| Molecular Weight | 389.24 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | (1aS,2S,7bR)-6-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-2-(hydroxymethyl)-1,1a,2,7b-tetrahydrocyclopropa[a]indolizin-4-one |
| SMILES | O=c1cc(-c2cc(Cl)ccc2-n2cc(Cl)nn2)cc2n1[C@H](CO)[C@H]1C[C@@H]21 |
| InChI | InChI=1S/C18H14Cl2N4O2/c19-10-1-2-14(23-7-17(20)21-22-23)11(5-10)9-3-15-12-6-13(12)16(8-25)24(15)18(26)4-9/h1-5,7,12-13,16,25H,6,8H2/t12-,13+,16-/m1/s1 |
| InChIKey | YLENYOPNJNAOCP-DVOMOZLQSA-N |
| XLogP | 3.05 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.24 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |