About tert-butyl 6-(2-bromoacetyl)-3-(1,3-dioxoisoindol-2-yl)-7-fluoroindazole-1-carboxylate
tert-butyl 6-(2-bromoacetyl)-3-(1,3-dioxoisoindol-2-yl)-7-fluoroindazole-1-carboxylate (PubChem CID 164842700) has the molecular formula C22H17BrFN3O5
and a molecular weight of 502.30 g/mol. Its IUPAC name is tert-butyl 6-(2-bromoacetyl)-3-(1,3-dioxoisoindol-2-yl)-7-fluoroindazole-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 6-(2-bromoacetyl)-3-(1,3-dioxoisoindol-2-yl)-7-fluoroindazole-1-carboxylate |
| PubChem CID | 164842700 |
| Molecular Formula | C22H17BrFN3O5 |
| Molecular Weight | 502.30 g/mol |
| Exact Mass | 501.03 |
| IUPAC Name | tert-butyl 6-(2-bromoacetyl)-3-(1,3-dioxoisoindol-2-yl)-7-fluoroindazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1nc(N2C(=O)c3ccccc3C2=O)c2ccc(C(=O)CBr)c(F)c21 |
| InChI | InChI=1S/C22H17BrFN3O5/c1-22(2,3)32-21(31)27-17-14(9-8-13(16(17)24)15(28)10-23)18(25-27)26-19(29)11-6-4-5-7-12(11)20(26)30/h4-9H,10H2,1-3H3 |
| InChIKey | DWYMOLNBAVOMPL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 98.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 502.30 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 6-(2-bromoacetyl)-3-(1,3-dioxoisoindol-2-yl)-7-fluoroindazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 6-(2-bromoacetyl)-3-(1,3-dioxoisoindol-2-yl)-7-fluoroindazole-1-carboxylate?
The IUPAC name of tert-butyl 6-(2-bromoacetyl)-3-(1,3-dioxoisoindol-2-yl)-7-fluoroindazole-1-carboxylate (CID 164842700) is tert-butyl 6-(2-bromoacetyl)-3-(1,3-dioxoisoindol-2-yl)-7-fluoroindazole-1-carboxylate.
What is the SMILES notation for tert-butyl 6-(2-bromoacetyl)-3-(1,3-dioxoisoindol-2-yl)-7-fluoroindazole-1-carboxylate?
The canonical SMILES for tert-butyl 6-(2-bromoacetyl)-3-(1,3-dioxoisoindol-2-yl)-7-fluoroindazole-1-carboxylate is CC(C)(C)OC(=O)n1nc(N2C(=O)c3ccccc3C2=O)c2ccc(C(=O)CBr)c(F)c21.
What is the InChIKey of tert-butyl 6-(2-bromoacetyl)-3-(1,3-dioxoisoindol-2-yl)-7-fluoroindazole-1-carboxylate?
The InChIKey is DWYMOLNBAVOMPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17BrFN3O5/c1-22(2,3)32-21(31)27-17-14(9-8-13(16(17)24)15(28)10-23)18(25-27)26-19(29)11-6-4-5-7-12(11)20(26)30/h4-9H,10H2,1-3H3.
What are the key properties of tert-butyl 6-(2-bromoacetyl)-3-(1,3-dioxoisoindol-2-yl)-7-fluoroindazole-1-carboxylate?
tert-butyl 6-(2-bromoacetyl)-3-(1,3-dioxoisoindol-2-yl)-7-fluoroindazole-1-carboxylate has a molecular weight of 502.30 g/mol, XLogP of 4.34, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 6-(2-bromoacetyl)-3-(1,3-dioxoisoindol-2-yl)-7-fluoroindazole-1-carboxylate is sourced from PubChem (CID 164842700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).