C19H22N3O6PS — CID 164842806
N,N-dimethyl-4-[2-nitro-5-[(2-oxo-1,3,2λ5-oxazaphosphinan-2-yl)sulfanylmethyl]phenoxy]benzamide (PubChem CID 164842806) has the molecular formula C19H22N3O6PS and a molecular weight of 451.44 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-nitro-5-[(2-oxo-1,3,2λ5-oxazaphosphinan-2-yl)sulfanylmethyl]phenoxy]benzamide.
| Compound Name | N,N-dimethyl-4-[2-nitro-5-[(2-oxo-1,3,2λ5-oxazaphosphinan-2-yl)sulfanylmethyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 164842806 |
| Molecular Formula | C19H22N3O6PS |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | N,N-dimethyl-4-[2-nitro-5-[(2-oxo-1,3,2λ5-oxazaphosphinan-2-yl)sulfanylmethyl]phenoxy]benzamide |
| SMILES | CN(C)C(=O)c1ccc(Oc2cc(CSP3(=O)NCCCO3)ccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H22N3O6PS/c1-21(2)19(23)15-5-7-16(8-6-15)28-18-12-14(4-9-17(18)22(24)25)13-30-29(26)20-10-3-11-27-29/h4-9,12H,3,10-11,13H2,1-2H3,(H,20,26) |
| InChIKey | ZAWHSYHAPCBHFG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|