C44H31N5 — CID 164843373
9-(2,3,4,5,6-pentadeuteriophenyl)-3-[4-[2-phenyl-4-(3-pyridin-3-ylphenyl)-1,2-dihydro-1,3,5-triazin-6-yl]phenyl]carbazole (PubChem CID 164843373) has the molecular formula C44H31N5 and a molecular weight of 634.80 g/mol. Its IUPAC name is 9-(2,3,4,5,6-pentadeuteriophenyl)-3-[4-[2-phenyl-4-(3-pyridin-3-ylphenyl)-1,2-dihydro-1,3,5-triazin-6-yl]phenyl]carbazole.
| Compound Name | 9-(2,3,4,5,6-pentadeuteriophenyl)-3-[4-[2-phenyl-4-(3-pyridin-3-ylphenyl)-1,2-dihydro-1,3,5-triazin-6-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 164843373 |
| Molecular Formula | C44H31N5 |
| Molecular Weight | 634.80 g/mol |
| Exact Mass | 634.29 |
| IUPAC Name | 9-(2,3,4,5,6-pentadeuteriophenyl)-3-[4-[2-phenyl-4-(3-pyridin-3-ylphenyl)-1,2-dihydro-1,3,5-triazin-6-yl]phenyl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-n2c3ccccc3c3cc(-c4ccc(C5=NC(c6cccc(-c7cccnc7)c6)=NC(c6ccccc6)N5)cc4)ccc32)c([2H])c1[2H] |
| InChI | InChI=1S/C44H31N5/c1-3-11-31(12-4-1)42-46-43(48-44(47-42)35-14-9-13-33(27-35)36-15-10-26-45-29-36)32-22-20-30(21-23-32)34-24-25-41-39(28-34)38-18-7-8-19-40(38)49(41)37-16-5-2-6-17-37/h1-29,42H,(H,46,47,48)/i2D,5D,6D,16D,17D |
| InChIKey | GEXZGOLRJUHUSQ-KZKSKIOJSA-N |
| XLogP | 10.01 |
| TPSA | 54.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.80 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |