C28H33FN10O6 — CID 164843966
benzyl N-[(1S)-1-[(2S,6R)-5-azido-6-[(1R,2R,3S,4R,6S)-4,6-diazido-2,3-dihydroxycyclohexyl]oxyoxan-2-yl]-2-fluoroethyl]-N-benzylcarbamate (PubChem CID 164843966) has the molecular formula C28H33FN10O6 and a molecular weight of 624.63 g/mol. Its IUPAC name is benzyl N-[(1S)-1-[(2S,6R)-5-azido-6-[(1R,2R,3S,4R,6S)-4,6-diazido-2,3-dihydroxycyclohexyl]oxyoxan-2-yl]-2-fluoroethyl]-N-benzylcarbamate.
| Compound Name | benzyl N-[(1S)-1-[(2S,6R)-5-azido-6-[(1R,2R,3S,4R,6S)-4,6-diazido-2,3-dihydroxycyclohexyl]oxyoxan-2-yl]-2-fluoroethyl]-N-benzylcarbamate |
|---|---|
| PubChem CID | 164843966 |
| Molecular Formula | C28H33FN10O6 |
| Molecular Weight | 624.63 g/mol |
| Exact Mass | 624.26 |
| IUPAC Name | benzyl N-[(1S)-1-[(2S,6R)-5-azido-6-[(1R,2R,3S,4R,6S)-4,6-diazido-2,3-dihydroxycyclohexyl]oxyoxan-2-yl]-2-fluoroethyl]-N-benzylcarbamate |
| SMILES | [N-]=[N+]=NC1CC[C@@H]([C@@H](CF)N(Cc2ccccc2)C(=O)OCc2ccccc2)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@H](N=[N+]=[N-])C[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C28H33FN10O6/c29-14-22(39(15-17-7-3-1-4-8-17)28(42)43-16-18-9-5-2-6-10-18)23-12-11-19(33-36-30)27(44-23)45-26-21(35-38-32)13-20(34-37-31)24(40)25(26)41/h1-10,19-27,40-41H,11-16H2/t19?,20-,21+,22-,23+,24+,25-,26-,27-/m1/s1 |
| InChIKey | QRQAYOHATLZKLV-NSKPLLGSSA-N |
| XLogP | 5.22 |
| TPSA | 234.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.63 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|