About benzyl N-[(1S)-1-[(2S,5S)-5-azido-6-hydroxyoxan-2-yl]-2-fluoroethyl]-N-benzylcarbamate
benzyl N-[(1S)-1-[(2S,5S)-5-azido-6-hydroxyoxan-2-yl]-2-fluoroethyl]-N-benzylcarbamate (PubChem CID 164843973) has the molecular formula C22H25FN4O4
and a molecular weight of 428.46 g/mol. Its IUPAC name is benzyl N-[(1S)-1-[(2S,5S)-5-azido-6-hydroxyoxan-2-yl]-2-fluoroethyl]-N-benzylcarbamate.
Molecular Properties
| Compound Name | benzyl N-[(1S)-1-[(2S,5S)-5-azido-6-hydroxyoxan-2-yl]-2-fluoroethyl]-N-benzylcarbamate |
| PubChem CID | 164843973 |
| Molecular Formula | C22H25FN4O4 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | benzyl N-[(1S)-1-[(2S,5S)-5-azido-6-hydroxyoxan-2-yl]-2-fluoroethyl]-N-benzylcarbamate |
| SMILES | [N-]=[N+]=N[C@H]1CC[C@@H]([C@@H](CF)N(Cc2ccccc2)C(=O)OCc2ccccc2)OC1O |
| InChI | InChI=1S/C22H25FN4O4/c23-13-19(20-12-11-18(25-26-24)21(28)31-20)27(14-16-7-3-1-4-8-16)22(29)30-15-17-9-5-2-6-10-17/h1-10,18-21,28H,11-15H2/t18-,19+,20-,21?/m0/s1 |
| InChIKey | OSJFCQAWCIMBTR-HWPVKAJDSA-N |
| XLogP | 4.34 |
| TPSA | 107.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze benzyl N-[(1S)-1-[(2S,5S)-5-azido-6-hydroxyoxan-2-yl]-2-fluoroethyl]-N-benzylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-[(1S)-1-[(2S,5S)-5-azido-6-hydroxyoxan-2-yl]-2-fluoroethyl]-N-benzylcarbamate?
The IUPAC name of benzyl N-[(1S)-1-[(2S,5S)-5-azido-6-hydroxyoxan-2-yl]-2-fluoroethyl]-N-benzylcarbamate (CID 164843973) is benzyl N-[(1S)-1-[(2S,5S)-5-azido-6-hydroxyoxan-2-yl]-2-fluoroethyl]-N-benzylcarbamate.
What is the SMILES notation for benzyl N-[(1S)-1-[(2S,5S)-5-azido-6-hydroxyoxan-2-yl]-2-fluoroethyl]-N-benzylcarbamate?
The canonical SMILES for benzyl N-[(1S)-1-[(2S,5S)-5-azido-6-hydroxyoxan-2-yl]-2-fluoroethyl]-N-benzylcarbamate is [N-]=[N+]=N[C@H]1CC[C@@H]([C@@H](CF)N(Cc2ccccc2)C(=O)OCc2ccccc2)OC1O.
What is the InChIKey of benzyl N-[(1S)-1-[(2S,5S)-5-azido-6-hydroxyoxan-2-yl]-2-fluoroethyl]-N-benzylcarbamate?
The InChIKey is OSJFCQAWCIMBTR-HWPVKAJDSA-N. The full InChI is InChI=1S/C22H25FN4O4/c23-13-19(20-12-11-18(25-26-24)21(28)31-20)27(14-16-7-3-1-4-8-16)22(29)30-15-17-9-5-2-6-10-17/h1-10,18-21,28H,11-15H2/t18-,19+,20-,21?/m0/s1.
What are the key properties of benzyl N-[(1S)-1-[(2S,5S)-5-azido-6-hydroxyoxan-2-yl]-2-fluoroethyl]-N-benzylcarbamate?
benzyl N-[(1S)-1-[(2S,5S)-5-azido-6-hydroxyoxan-2-yl]-2-fluoroethyl]-N-benzylcarbamate has a molecular weight of 428.46 g/mol, XLogP of 4.34, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[(1S)-1-[(2S,5S)-5-azido-6-hydroxyoxan-2-yl]-2-fluoroethyl]-N-benzylcarbamate is sourced from PubChem (CID 164843973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).