C12H25N3O6 — CID 164843996
4-amino-N-[(1R,2S,3R,4R,5S)-5-amino-2-hydroxy-3,4-dimethoxycyclohexyl]-2,3-dihydroxybutanamide (PubChem CID 164843996) has the molecular formula C12H25N3O6 and a molecular weight of 307.35 g/mol. Its IUPAC name is 4-amino-N-[(1R,2S,3R,4R,5S)-5-amino-2-hydroxy-3,4-dimethoxycyclohexyl]-2,3-dihydroxybutanamide.
| Compound Name | 4-amino-N-[(1R,2S,3R,4R,5S)-5-amino-2-hydroxy-3,4-dimethoxycyclohexyl]-2,3-dihydroxybutanamide |
|---|---|
| PubChem CID | 164843996 |
| Molecular Formula | C12H25N3O6 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 4-amino-N-[(1R,2S,3R,4R,5S)-5-amino-2-hydroxy-3,4-dimethoxycyclohexyl]-2,3-dihydroxybutanamide |
| SMILES | CO[C@@H]1[C@@H](O)[C@H](NC(=O)C(O)C(O)CN)C[C@H](N)[C@H]1OC |
| InChI | InChI=1S/C12H25N3O6/c1-20-10-5(14)3-6(8(17)11(10)21-2)15-12(19)9(18)7(16)4-13/h5-11,16-18H,3-4,13-14H2,1-2H3,(H,15,19)/t5-,6+,7?,8-,9?,10+,11+/m0/s1 |
| InChIKey | IYRNJFVROFAOBB-KKIAJMMVSA-N |
| XLogP | -3.73 |
| TPSA | 160.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | -3.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |