C13H19FO7 — CID 164844020
[(2R)-2-[(3aR,5R,6S,6aS)-6-fluoro-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-acetyloxyethyl] acetate (PubChem CID 164844020) has the molecular formula C13H19FO7 and a molecular weight of 306.29 g/mol. Its IUPAC name is [(2R)-2-[(3aR,5R,6S,6aS)-6-fluoro-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-acetyloxyethyl] acetate.
| Compound Name | [(2R)-2-[(3aR,5R,6S,6aS)-6-fluoro-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-acetyloxyethyl] acetate |
|---|---|
| PubChem CID | 164844020 |
| Molecular Formula | C13H19FO7 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | [(2R)-2-[(3aR,5R,6S,6aS)-6-fluoro-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-acetyloxyethyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1F |
| InChI | InChI=1S/C13H19FO7/c1-6(15)17-5-8(18-7(2)16)10-9(14)11-12(19-10)21-13(3,4)20-11/h8-12H,5H2,1-4H3/t8-,9+,10-,11-,12-/m1/s1 |
| InChIKey | RHXJPKBGLQAIEZ-IYKVGLELSA-N |
| XLogP | 0.70 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |