C17H23FN6O2S — CID 164844025
(2R,3R,4R,5R,6S)-5-azido-2-(azidomethyl)-3-butoxy-4-fluoro-6-(4-methylphenyl)sulfanyloxane (PubChem CID 164844025) has the molecular formula C17H23FN6O2S and a molecular weight of 394.48 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-5-azido-2-(azidomethyl)-3-butoxy-4-fluoro-6-(4-methylphenyl)sulfanyloxane.
| Compound Name | (2R,3R,4R,5R,6S)-5-azido-2-(azidomethyl)-3-butoxy-4-fluoro-6-(4-methylphenyl)sulfanyloxane |
|---|---|
| PubChem CID | 164844025 |
| Molecular Formula | C17H23FN6O2S |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (2R,3R,4R,5R,6S)-5-azido-2-(azidomethyl)-3-butoxy-4-fluoro-6-(4-methylphenyl)sulfanyloxane |
| SMILES | CCCCO[C@H]1[C@H](F)[C@@H](N=[N+]=[N-])[C@H](Sc2ccc(C)cc2)O[C@@H]1CN=[N+]=[N-] |
| InChI | InChI=1S/C17H23FN6O2S/c1-3-4-9-25-16-13(10-21-23-19)26-17(15(14(16)18)22-24-20)27-12-7-5-11(2)6-8-12/h5-8,13-17H,3-4,9-10H2,1-2H3/t13-,14-,15-,16-,17+/m1/s1 |
| InChIKey | VXNANSISLVUNDB-HHARLNAUSA-N |
| XLogP | 5.32 |
| TPSA | 115.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|