C31H22FN5O3 — CID 164844322
2-[6-(2,3-dihydro-1H-inden-4-ylamino)-5-fluoro-1-phenacylpyrazolo[3,4-b]pyridin-3-yl]isoindole-1,3-dione (PubChem CID 164844322) has the molecular formula C31H22FN5O3 and a molecular weight of 531.55 g/mol. Its IUPAC name is 2-[6-(2,3-dihydro-1H-inden-4-ylamino)-5-fluoro-1-phenacylpyrazolo[3,4-b]pyridin-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[6-(2,3-dihydro-1H-inden-4-ylamino)-5-fluoro-1-phenacylpyrazolo[3,4-b]pyridin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 164844322 |
| Molecular Formula | C31H22FN5O3 |
| Molecular Weight | 531.55 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | 2-[6-(2,3-dihydro-1H-inden-4-ylamino)-5-fluoro-1-phenacylpyrazolo[3,4-b]pyridin-3-yl]isoindole-1,3-dione |
| SMILES | O=C(Cn1nc(N2C(=O)c3ccccc3C2=O)c2cc(F)c(Nc3cccc4c3CCC4)nc21)c1ccccc1 |
| InChI | InChI=1S/C31H22FN5O3/c32-24-16-23-28(34-27(24)33-25-15-7-11-18-10-6-14-20(18)25)36(17-26(38)19-8-2-1-3-9-19)35-29(23)37-30(39)21-12-4-5-13-22(21)31(37)40/h1-5,7-9,11-13,15-16H,6,10,14,17H2,(H,33,34) |
| InChIKey | MPRDGAAWUHASLH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|