C24H19N5O2 — CID 164844333
2-[6-(2,3-dihydro-1H-inden-4-ylamino)-5-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl]isoindole-1,3-dione (PubChem CID 164844333) has the molecular formula C24H19N5O2 and a molecular weight of 409.45 g/mol. Its IUPAC name is 2-[6-(2,3-dihydro-1H-inden-4-ylamino)-5-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[6-(2,3-dihydro-1H-inden-4-ylamino)-5-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 164844333 |
| Molecular Formula | C24H19N5O2 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 2-[6-(2,3-dihydro-1H-inden-4-ylamino)-5-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl]isoindole-1,3-dione |
| SMILES | Cc1cc2c(N3C(=O)c4ccccc4C3=O)n[nH]c2nc1Nc1cccc2c1CCC2 |
| InChI | InChI=1S/C24H19N5O2/c1-13-12-18-21(26-20(13)25-19-11-5-7-14-6-4-10-15(14)19)27-28-22(18)29-23(30)16-8-2-3-9-17(16)24(29)31/h2-3,5,7-9,11-12H,4,6,10H2,1H3,(H2,25,26,27,28) |
| InChIKey | CIMWPRCGHYYIHT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|