C30H22FN5O2 — CID 164844378
2-[1-benzyl-6-(2,3-dihydro-1H-inden-4-ylamino)-5-fluoropyrazolo[3,4-b]pyridin-3-yl]isoindole-1,3-dione (PubChem CID 164844378) has the molecular formula C30H22FN5O2 and a molecular weight of 503.54 g/mol. Its IUPAC name is 2-[1-benzyl-6-(2,3-dihydro-1H-inden-4-ylamino)-5-fluoropyrazolo[3,4-b]pyridin-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-benzyl-6-(2,3-dihydro-1H-inden-4-ylamino)-5-fluoropyrazolo[3,4-b]pyridin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 164844378 |
| Molecular Formula | C30H22FN5O2 |
| Molecular Weight | 503.54 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | 2-[1-benzyl-6-(2,3-dihydro-1H-inden-4-ylamino)-5-fluoropyrazolo[3,4-b]pyridin-3-yl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1nn(Cc2ccccc2)c2nc(Nc3cccc4c3CCC4)c(F)cc12 |
| InChI | InChI=1S/C30H22FN5O2/c31-24-16-23-27(33-26(24)32-25-15-7-11-19-10-6-14-20(19)25)35(17-18-8-2-1-3-9-18)34-28(23)36-29(37)21-12-4-5-13-22(21)30(36)38/h1-5,7-9,11-13,15-16H,6,10,14,17H2,(H,32,33) |
| InChIKey | KKRUNJIOMIARQQ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.54 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|