C26H44N2O8 — CID 164844479
[(2S,4S,5R)-5-[(2S)-1-acetamido-2-methoxy-2-methylpentyl]-4-[(Z)-3-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]prop-1-enyl]pyrrolidin-2-yl] formate (PubChem CID 164844479) has the molecular formula C26H44N2O8 and a molecular weight of 512.64 g/mol. Its IUPAC name is [(2S,4S,5R)-5-[(2S)-1-acetamido-2-methoxy-2-methylpentyl]-4-[(Z)-3-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]prop-1-enyl]pyrrolidin-2-yl] formate.
| Compound Name | [(2S,4S,5R)-5-[(2S)-1-acetamido-2-methoxy-2-methylpentyl]-4-[(Z)-3-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]prop-1-enyl]pyrrolidin-2-yl] formate |
|---|---|
| PubChem CID | 164844479 |
| Molecular Formula | C26H44N2O8 |
| Molecular Weight | 512.64 g/mol |
| Exact Mass | 512.31 |
| IUPAC Name | [(2S,4S,5R)-5-[(2S)-1-acetamido-2-methoxy-2-methylpentyl]-4-[(Z)-3-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]prop-1-enyl]pyrrolidin-2-yl] formate |
| SMILES | C#CCOCCOCCOCCOC/C=C\[C@@H]1C[C@H](OC=O)N[C@H]1C(NC(C)=O)[C@](C)(CCC)OC |
| InChI | InChI=1S/C26H44N2O8/c1-6-10-26(4,31-5)25(27-21(3)30)24-22(19-23(28-24)36-20-29)9-8-12-33-14-16-35-18-17-34-15-13-32-11-7-2/h2,8-9,20,22-25,28H,6,10-19H2,1,3-5H3,(H,27,30)/b9-8-/t22-,23+,24-,25?,26+/m1/s1 |
| InChIKey | JKDVYANRQKJYIF-NBUONHMJSA-N |
| XLogP | 1.43 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.64 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|