C16H17N5O2S — CID 164844591
N-[5-[[(2R,3S)-3-[(5-isocyano-2-pyridinyl)oxy]-2-methylazetidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 164844591) has the molecular formula C16H17N5O2S and a molecular weight of 343.41 g/mol. Its IUPAC name is N-[5-[[(2R,3S)-3-[(5-isocyano-2-pyridinyl)oxy]-2-methylazetidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-[[(2R,3S)-3-[(5-isocyano-2-pyridinyl)oxy]-2-methylazetidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 164844591 |
| Molecular Formula | C16H17N5O2S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N-[5-[[(2R,3S)-3-[(5-isocyano-2-pyridinyl)oxy]-2-methylazetidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | [C-]#[N+]c1ccc(O[C@H]2CN(Cc3cnc(NC(C)=O)s3)[C@@H]2C)nc1 |
| InChI | InChI=1S/C16H17N5O2S/c1-10-14(23-15-5-4-12(17-3)6-18-15)9-21(10)8-13-7-19-16(24-13)20-11(2)22/h4-7,10,14H,8-9H2,1-2H3,(H,19,20,22)/t10-,14+/m1/s1 |
| InChIKey | MUDMWXUXXZWSCH-YGRLFVJLSA-N |
| XLogP | 2.70 |
| TPSA | 71.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|