C6H6F5NO3S — CID 164845146
(E)-N-(1,1,2,2,2-pentafluoroethylsulfonyl)but-2-enamide (PubChem CID 164845146) has the molecular formula C6H6F5NO3S and a molecular weight of 267.18 g/mol. Its IUPAC name is (E)-N-(1,1,2,2,2-pentafluoroethylsulfonyl)but-2-enamide.
| Compound Name | (E)-N-(1,1,2,2,2-pentafluoroethylsulfonyl)but-2-enamide |
|---|---|
| PubChem CID | 164845146 |
| Molecular Formula | C6H6F5NO3S |
| Molecular Weight | 267.18 g/mol |
| Exact Mass | 267.00 |
| IUPAC Name | (E)-N-(1,1,2,2,2-pentafluoroethylsulfonyl)but-2-enamide |
| SMILES | C/C=C/C(=O)NS(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H6F5NO3S/c1-2-3-4(13)12-16(14,15)6(10,11)5(7,8)9/h2-3H,1H3,(H,12,13)/b3-2+ |
| InChIKey | KBYVVNLNRYQUKK-NSCUHMNNSA-N |
| XLogP | 1.16 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.18 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|