C11H8F4O3 — CID 164845170
ethyl (Z)-3-hydroxy-3-(2,3,4,5-tetrafluorophenyl)prop-2-enoate (PubChem CID 164845170) has the molecular formula C11H8F4O3 and a molecular weight of 264.17 g/mol. Its IUPAC name is ethyl (Z)-3-hydroxy-3-(2,3,4,5-tetrafluorophenyl)prop-2-enoate.
| Compound Name | ethyl (Z)-3-hydroxy-3-(2,3,4,5-tetrafluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 164845170 |
| Molecular Formula | C11H8F4O3 |
| Molecular Weight | 264.17 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | ethyl (Z)-3-hydroxy-3-(2,3,4,5-tetrafluorophenyl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C(\O)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H8F4O3/c1-2-18-8(17)4-7(16)5-3-6(12)10(14)11(15)9(5)13/h3-4,16H,2H2,1H3/b7-4- |
| InChIKey | SUHJYTWDWWAHOF-DAXSKMNVSA-N |
| XLogP | 2.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.17 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|