C34H32N4O3 — CID 164846275
2-[4-[N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-4-(1-isocyanocyclopropyl)anilino]butyl]isoindole-1,3-dione (PubChem CID 164846275) has the molecular formula C34H32N4O3 and a molecular weight of 544.66 g/mol. Its IUPAC name is 2-[4-[N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-4-(1-isocyanocyclopropyl)anilino]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-4-(1-isocyanocyclopropyl)anilino]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 164846275 |
| Molecular Formula | C34H32N4O3 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | 2-[4-[N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-4-(1-isocyanocyclopropyl)anilino]butyl]isoindole-1,3-dione |
| SMILES | [C-]#[N+]C1(c2ccc(N(CCCCN3C(=O)c4ccccc4C3=O)c3cc(-c4c(C)noc4C)ccc3C)cc2)CC1 |
| InChI | InChI=1S/C34H32N4O3/c1-22-11-12-25(31-23(2)36-41-24(31)3)21-30(22)37(27-15-13-26(14-16-27)34(35-4)17-18-34)19-7-8-20-38-32(39)28-9-5-6-10-29(28)33(38)40/h5-6,9-16,21H,7-8,17-20H2,1-3H3 |
| InChIKey | DDMCHBRKPZTXIG-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 71.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|