C32H43N3O2Si — CID 164846653
N-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-5-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[4-(1-isocyanocyclopropyl)phenyl]-2-methylaniline (PubChem CID 164846653) has the molecular formula C32H43N3O2Si and a molecular weight of 529.80 g/mol. Its IUPAC name is N-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-5-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[4-(1-isocyanocyclopropyl)phenyl]-2-methylaniline.
| Compound Name | N-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-5-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[4-(1-isocyanocyclopropyl)phenyl]-2-methylaniline |
|---|---|
| PubChem CID | 164846653 |
| Molecular Formula | C32H43N3O2Si |
| Molecular Weight | 529.80 g/mol |
| Exact Mass | 529.31 |
| IUPAC Name | N-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-5-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[4-(1-isocyanocyclopropyl)phenyl]-2-methylaniline |
| SMILES | [C-]#[N+]C1(c2ccc(N(CCCCO[Si](C)(C)C(C)(C)C)c3cc(-c4c(C)noc4C)ccc3C)cc2)CC1 |
| InChI | InChI=1S/C32H43N3O2Si/c1-23-12-13-26(30-24(2)34-37-25(30)3)22-29(23)35(20-10-11-21-36-38(8,9)31(4,5)6)28-16-14-27(15-17-28)32(33-7)18-19-32/h12-17,22H,10-11,18-21H2,1-6,8-9H3 |
| InChIKey | QRNODFSGLSYGLZ-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 42.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.80 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|