C15H15Br — CID 164847127
1-bromo-2,3,4,6-tetradeuterio-5-[2-(2,3,4,5,6-pentadeuteriophenyl)propan-2-yl]benzene (PubChem CID 164847127) has the molecular formula C15H15Br and a molecular weight of 284.24 g/mol. Its IUPAC name is 1-bromo-2,3,4,6-tetradeuterio-5-[2-(2,3,4,5,6-pentadeuteriophenyl)propan-2-yl]benzene.
| Compound Name | 1-bromo-2,3,4,6-tetradeuterio-5-[2-(2,3,4,5,6-pentadeuteriophenyl)propan-2-yl]benzene |
|---|---|
| PubChem CID | 164847127 |
| Molecular Formula | C15H15Br |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 1-bromo-2,3,4,6-tetradeuterio-5-[2-(2,3,4,5,6-pentadeuteriophenyl)propan-2-yl]benzene |
| SMILES | [2H]c1c([2H])c([2H])c(C(C)(C)c2c([2H])c([2H])c([2H])c(Br)c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C15H15Br/c1-15(2,12-7-4-3-5-8-12)13-9-6-10-14(16)11-13/h3-11H,1-2H3/i3D,4D,5D,6D,7D,8D,9D,10D,11D |
| InChIKey | IWIFOMIXTHQRNJ-MFPZSLDBSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |