C20H25ClN6O2 — CID 164848052
2-[4-[5-chloro-1-(1-methylpyrazol-4-yl)indazol-6-yl]piperazin-1-yl]-4-methyloxolan-3-ol (PubChem CID 164848052) has the molecular formula C20H25ClN6O2 and a molecular weight of 416.91 g/mol. Its IUPAC name is 2-[4-[5-chloro-1-(1-methylpyrazol-4-yl)indazol-6-yl]piperazin-1-yl]-4-methyloxolan-3-ol.
| Compound Name | 2-[4-[5-chloro-1-(1-methylpyrazol-4-yl)indazol-6-yl]piperazin-1-yl]-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 164848052 |
| Molecular Formula | C20H25ClN6O2 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 2-[4-[5-chloro-1-(1-methylpyrazol-4-yl)indazol-6-yl]piperazin-1-yl]-4-methyloxolan-3-ol |
| SMILES | CC1COC(N2CCN(c3cc4c(cnn4-c4cnn(C)c4)cc3Cl)CC2)C1O |
| InChI | InChI=1S/C20H25ClN6O2/c1-13-12-29-20(19(13)28)26-5-3-25(4-6-26)18-8-17-14(7-16(18)21)9-23-27(17)15-10-22-24(2)11-15/h7-11,13,19-20,28H,3-6,12H2,1-2H3 |
| InChIKey | VVQLMBOMJOUVFJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |