About methanethiolate;2-methylpropane;yttrium
methanethiolate;2-methylpropane;yttrium (PubChem CID 164848355) has the molecular formula C5H12SY-2
and a molecular weight of 193.12 g/mol. Its IUPAC name is methanethiolate;2-methylpropane;yttrium.
Molecular Properties
| Compound Name | methanethiolate;2-methylpropane;yttrium |
| PubChem CID | 164848355 |
| Molecular Formula | C5H12SY-2 |
| Molecular Weight | 193.12 g/mol |
| Exact Mass | 192.97 |
| IUPAC Name | methanethiolate;2-methylpropane;yttrium |
| SMILES | C[C-](C)C.C[S-].[Y] |
| InChI | InChI=1S/C4H9.CH4S.Y/c1-4(2)3;1-2;/h1-3H3;2H,1H3;/q-1;;/p-1 |
| InChIKey | RSLJFYVJIYTVLK-UHFFFAOYSA-M |
| XLogP | 1.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.12 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze methanethiolate;2-methylpropane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanethiolate;2-methylpropane;yttrium?
The IUPAC name of methanethiolate;2-methylpropane;yttrium (CID 164848355) is methanethiolate;2-methylpropane;yttrium.
What is the SMILES notation for methanethiolate;2-methylpropane;yttrium?
The canonical SMILES for methanethiolate;2-methylpropane;yttrium is C[C-](C)C.C[S-].[Y].
What is the InChIKey of methanethiolate;2-methylpropane;yttrium?
The InChIKey is RSLJFYVJIYTVLK-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H9.CH4S.Y/c1-4(2)3;1-2;/h1-3H3;2H,1H3;/q-1;;/p-1.
What are the key properties of methanethiolate;2-methylpropane;yttrium?
methanethiolate;2-methylpropane;yttrium has a molecular weight of 193.12 g/mol, XLogP of 1.78, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methanethiolate;2-methylpropane;yttrium is sourced from PubChem (CID 164848355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).