About 5-isocyanopyrazolo[5,1-a]isoquinolin-10-ol
5-isocyanopyrazolo[5,1-a]isoquinolin-10-ol (PubChem CID 164848809) has the molecular formula C12H7N3O
and a molecular weight of 209.21 g/mol. Its IUPAC name is 5-isocyanopyrazolo[5,1-a]isoquinolin-10-ol.
Molecular Properties
| Compound Name | 5-isocyanopyrazolo[5,1-a]isoquinolin-10-ol |
| PubChem CID | 164848809 |
| Molecular Formula | C12H7N3O |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 5-isocyanopyrazolo[5,1-a]isoquinolin-10-ol |
| SMILES | [C-]#[N+]c1cc2cccc(O)c2c2ccnn12 |
| InChI | InChI=1S/C12H7N3O/c1-13-11-7-8-3-2-4-10(16)12(8)9-5-6-14-15(9)11/h2-7,16H |
| InChIKey | CVVAUMYWLPGHBI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 41.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5-isocyanopyrazolo[5,1-a]isoquinolin-10-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-isocyanopyrazolo[5,1-a]isoquinolin-10-ol?
The IUPAC name of 5-isocyanopyrazolo[5,1-a]isoquinolin-10-ol (CID 164848809) is 5-isocyanopyrazolo[5,1-a]isoquinolin-10-ol.
What is the SMILES notation for 5-isocyanopyrazolo[5,1-a]isoquinolin-10-ol?
The canonical SMILES for 5-isocyanopyrazolo[5,1-a]isoquinolin-10-ol is [C-]#[N+]c1cc2cccc(O)c2c2ccnn12.
What is the InChIKey of 5-isocyanopyrazolo[5,1-a]isoquinolin-10-ol?
The InChIKey is CVVAUMYWLPGHBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7N3O/c1-13-11-7-8-3-2-4-10(16)12(8)9-5-6-14-15(9)11/h2-7,16H.
What are the key properties of 5-isocyanopyrazolo[5,1-a]isoquinolin-10-ol?
5-isocyanopyrazolo[5,1-a]isoquinolin-10-ol has a molecular weight of 209.21 g/mol, XLogP of 2.74, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-isocyanopyrazolo[5,1-a]isoquinolin-10-ol is sourced from PubChem (CID 164848809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).