C28H23FN9Pt- — CID 164849095
8-fluoro-2,9-dimethyl-10H-benzo[h]quinolin-10-ide;platinum;1-[tri(pyrazol-1-yl)methyl]pyrazole (PubChem CID 164849095) has the molecular formula C28H23FN9Pt- and a molecular weight of 699.63 g/mol. Its IUPAC name is 8-fluoro-2,9-dimethyl-10H-benzo[h]quinolin-10-ide;platinum;1-[tri(pyrazol-1-yl)methyl]pyrazole.
| Compound Name | 8-fluoro-2,9-dimethyl-10H-benzo[h]quinolin-10-ide;platinum;1-[tri(pyrazol-1-yl)methyl]pyrazole |
|---|---|
| PubChem CID | 164849095 |
| Molecular Formula | C28H23FN9Pt- |
| Molecular Weight | 699.63 g/mol |
| Exact Mass | 699.17 |
| IUPAC Name | 8-fluoro-2,9-dimethyl-10H-benzo[h]quinolin-10-ide;platinum;1-[tri(pyrazol-1-yl)methyl]pyrazole |
| SMILES | Cc1ccc2ccc3cc(F)c(C)[c-]c3c2n1.[Pt].c1cnn(C(n2cccn2)(n2cccn2)n2cccn2)c1 |
| InChI | InChI=1S/C15H11FN.C13H12N8.Pt/c1-9-7-13-12(8-14(9)16)6-5-11-4-3-10(2)17-15(11)13;1-5-14-18(9-1)13(19-10-2-6-15-19,20-11-3-7-16-20)21-12-4-8-17-21;/h3-6,8H,1-2H3;1-12H;/q-1;; |
| InChIKey | ATUFGJKGFXFEKV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 84.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.63 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|