C29H19FN3O2+ — CID 164849501
6-[3-fluoro-7-methyl-6-(3-methylpyrimidin-3-ium-4-yl)dibenzofuran-4-yl]-[1]benzofuro[2,3-b]pyridine (PubChem CID 164849501) has the molecular formula C29H19FN3O2+ and a molecular weight of 460.49 g/mol. Its IUPAC name is 6-[3-fluoro-7-methyl-6-(3-methylpyrimidin-3-ium-4-yl)dibenzofuran-4-yl]-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 6-[3-fluoro-7-methyl-6-(3-methylpyrimidin-3-ium-4-yl)dibenzofuran-4-yl]-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 164849501 |
| Molecular Formula | C29H19FN3O2+ |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 6-[3-fluoro-7-methyl-6-(3-methylpyrimidin-3-ium-4-yl)dibenzofuran-4-yl]-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccc2c(oc3c(-c4ccc5oc6ncccc6c5c4)c(F)ccc32)c1-c1ccnc[n+]1C |
| InChI | InChI=1S/C29H19FN3O2/c1-16-5-7-18-19-8-9-22(30)26(28(19)35-27(18)25(16)23-11-13-31-15-33(23)2)17-6-10-24-21(14-17)20-4-3-12-32-29(20)34-24/h3-15H,1-2H3/q+1 |
| InChIKey | FQWAMRSITKCPIQ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 55.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|