C34H23FN3O2+ — CID 164849703
6-[3-fluoro-7-methyl-6-(1-methyl-3-phenylimidazol-1-ium-2-yl)dibenzofuran-4-yl]-[1]benzofuro[2,3-b]pyridine (PubChem CID 164849703) has the molecular formula C34H23FN3O2+ and a molecular weight of 524.58 g/mol. Its IUPAC name is 6-[3-fluoro-7-methyl-6-(1-methyl-3-phenylimidazol-1-ium-2-yl)dibenzofuran-4-yl]-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 6-[3-fluoro-7-methyl-6-(1-methyl-3-phenylimidazol-1-ium-2-yl)dibenzofuran-4-yl]-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 164849703 |
| Molecular Formula | C34H23FN3O2+ |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | 6-[3-fluoro-7-methyl-6-(1-methyl-3-phenylimidazol-1-ium-2-yl)dibenzofuran-4-yl]-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccc2c(oc3c(-c4ccc5oc6ncccc6c5c4)c(F)ccc32)c1-c1n(-c2ccccc2)cc[n+]1C |
| InChI | InChI=1S/C34H23FN3O2/c1-20-10-12-23-24-13-14-27(35)30(21-11-15-28-26(19-21)25-9-6-16-36-33(25)39-28)32(24)40-31(23)29(20)34-37(2)17-18-38(34)22-7-4-3-5-8-22/h3-19H,1-2H3/q+1 |
| InChIKey | LUGDVDZVNKKTEV-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 47.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|