C21H16N2 — CID 164850348
1-propan-2-yl-4-tetradeca-1,3,5,7,9,11,13-heptaynylpiperazine (PubChem CID 164850348) has the molecular formula C21H16N2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 1-propan-2-yl-4-tetradeca-1,3,5,7,9,11,13-heptaynylpiperazine.
| Compound Name | 1-propan-2-yl-4-tetradeca-1,3,5,7,9,11,13-heptaynylpiperazine |
|---|---|
| PubChem CID | 164850348 |
| Molecular Formula | C21H16N2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 1-propan-2-yl-4-tetradeca-1,3,5,7,9,11,13-heptaynylpiperazine |
| SMILES | C#CC#CC#CC#CC#CC#CC#CN1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C21H16N2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-22-17-19-23(20-18-22)21(2)3/h1,21H,17-20H2,2-3H3 |
| InChIKey | JRISEZFBZGWLRC-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|