About 4-(2-ethoxy-4,5-difluoro-3-nitrophenyl)-3,6-dihydro-2H-pyran
4-(2-ethoxy-4,5-difluoro-3-nitrophenyl)-3,6-dihydro-2H-pyran (PubChem CID 164850369) has the molecular formula C13H13F2NO4
and a molecular weight of 285.25 g/mol. Its IUPAC name is 4-(2-ethoxy-4,5-difluoro-3-nitrophenyl)-3,6-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 4-(2-ethoxy-4,5-difluoro-3-nitrophenyl)-3,6-dihydro-2H-pyran |
| PubChem CID | 164850369 |
| Molecular Formula | C13H13F2NO4 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 4-(2-ethoxy-4,5-difluoro-3-nitrophenyl)-3,6-dihydro-2H-pyran |
| SMILES | CCOc1c(C2=CCOCC2)cc(F)c(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H13F2NO4/c1-2-20-13-9(8-3-5-19-6-4-8)7-10(14)11(15)12(13)16(17)18/h3,7H,2,4-6H2,1H3 |
| InChIKey | ZXNBWIJYGQYGNZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-ethoxy-4,5-difluoro-3-nitrophenyl)-3,6-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-ethoxy-4,5-difluoro-3-nitrophenyl)-3,6-dihydro-2H-pyran?
The IUPAC name of 4-(2-ethoxy-4,5-difluoro-3-nitrophenyl)-3,6-dihydro-2H-pyran (CID 164850369) is 4-(2-ethoxy-4,5-difluoro-3-nitrophenyl)-3,6-dihydro-2H-pyran.
What is the SMILES notation for 4-(2-ethoxy-4,5-difluoro-3-nitrophenyl)-3,6-dihydro-2H-pyran?
The canonical SMILES for 4-(2-ethoxy-4,5-difluoro-3-nitrophenyl)-3,6-dihydro-2H-pyran is CCOc1c(C2=CCOCC2)cc(F)c(F)c1[N+](=O)[O-].
What is the InChIKey of 4-(2-ethoxy-4,5-difluoro-3-nitrophenyl)-3,6-dihydro-2H-pyran?
The InChIKey is ZXNBWIJYGQYGNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F2NO4/c1-2-20-13-9(8-3-5-19-6-4-8)7-10(14)11(15)12(13)16(17)18/h3,7H,2,4-6H2,1H3.
What are the key properties of 4-(2-ethoxy-4,5-difluoro-3-nitrophenyl)-3,6-dihydro-2H-pyran?
4-(2-ethoxy-4,5-difluoro-3-nitrophenyl)-3,6-dihydro-2H-pyran has a molecular weight of 285.25 g/mol, XLogP of 3.08, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-ethoxy-4,5-difluoro-3-nitrophenyl)-3,6-dihydro-2H-pyran is sourced from PubChem (CID 164850369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).