C26H36O6 — CID 164850655
(1R,2S,3R,4R,5R,6S)-1,2-bis[3-(4-methylphenyl)propyl]cyclohexane-1,2,3,4,5,6-hexol (PubChem CID 164850655) has the molecular formula C26H36O6 and a molecular weight of 444.57 g/mol. Its IUPAC name is (1R,2S,3R,4R,5R,6S)-1,2-bis[3-(4-methylphenyl)propyl]cyclohexane-1,2,3,4,5,6-hexol.
| Compound Name | (1R,2S,3R,4R,5R,6S)-1,2-bis[3-(4-methylphenyl)propyl]cyclohexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 164850655 |
| Molecular Formula | C26H36O6 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | (1R,2S,3R,4R,5R,6S)-1,2-bis[3-(4-methylphenyl)propyl]cyclohexane-1,2,3,4,5,6-hexol |
| SMILES | Cc1ccc(CCC[C@@]2(O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@@]2(O)CCCc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H36O6/c1-17-7-11-19(12-8-17)5-3-15-25(31)23(29)21(27)22(28)24(30)26(25,32)16-4-6-20-13-9-18(2)10-14-20/h7-14,21-24,27-32H,3-6,15-16H2,1-2H3/t21-,22-,23-,24+,25+,26-/m1/s1 |
| InChIKey | AVQSAOMOICVZAQ-GNPXQVHSSA-N |
| XLogP | 1.57 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |