C25H24FN7O — CID 164850776
[(1S,6R,7R)-3-[3-(2,3-dihydrofuro[2,3-b]pyridin-4-yl)-2H-pyrazolo[3,4-b]pyrazin-6-yl]-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-7-yl]methanamine (PubChem CID 164850776) has the molecular formula C25H24FN7O and a molecular weight of 457.51 g/mol. Its IUPAC name is [(1S,6R,7R)-3-[3-(2,3-dihydrofuro[2,3-b]pyridin-4-yl)-2H-pyrazolo[3,4-b]pyrazin-6-yl]-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-7-yl]methanamine.
| Compound Name | [(1S,6R,7R)-3-[3-(2,3-dihydrofuro[2,3-b]pyridin-4-yl)-2H-pyrazolo[3,4-b]pyrazin-6-yl]-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-7-yl]methanamine |
|---|---|
| PubChem CID | 164850776 |
| Molecular Formula | C25H24FN7O |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | [(1S,6R,7R)-3-[3-(2,3-dihydrofuro[2,3-b]pyridin-4-yl)-2H-pyrazolo[3,4-b]pyrazin-6-yl]-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-7-yl]methanamine |
| SMILES | NC[C@]1(c2ccccc2F)[C@@H]2CCN(c3cnc4c(-c5ccnc6c5CCO6)[nH]nc4n3)C[C@@H]21 |
| InChI | InChI=1S/C25H24FN7O/c26-19-4-2-1-3-17(19)25(13-27)16-6-9-33(12-18(16)25)20-11-29-22-21(31-32-23(22)30-20)14-5-8-28-24-15(14)7-10-34-24/h1-5,8,11,16,18H,6-7,9-10,12-13,27H2,(H,30,31,32)/t16-,18+,25-/m1/s1 |
| InChIKey | NQTJYLAFOZCBDW-JTWNBILESA-N |
| XLogP | 2.84 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |