C26H24F2N8O — CID 164850788
[(1S,6R,7S)-3-[3-[8-(difluoromethyl)quinolin-5-yl]-2H-pyrazolo[3,4-b]pyrazin-6-yl]-7-(5-methyl-1,2-oxazol-3-yl)-3-azabicyclo[4.1.0]heptan-7-yl]methanamine (PubChem CID 164850788) has the molecular formula C26H24F2N8O and a molecular weight of 502.53 g/mol. Its IUPAC name is [(1S,6R,7S)-3-[3-[8-(difluoromethyl)quinolin-5-yl]-2H-pyrazolo[3,4-b]pyrazin-6-yl]-7-(5-methyl-1,2-oxazol-3-yl)-3-azabicyclo[4.1.0]heptan-7-yl]methanamine.
| Compound Name | [(1S,6R,7S)-3-[3-[8-(difluoromethyl)quinolin-5-yl]-2H-pyrazolo[3,4-b]pyrazin-6-yl]-7-(5-methyl-1,2-oxazol-3-yl)-3-azabicyclo[4.1.0]heptan-7-yl]methanamine |
|---|---|
| PubChem CID | 164850788 |
| Molecular Formula | C26H24F2N8O |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | [(1S,6R,7S)-3-[3-[8-(difluoromethyl)quinolin-5-yl]-2H-pyrazolo[3,4-b]pyrazin-6-yl]-7-(5-methyl-1,2-oxazol-3-yl)-3-azabicyclo[4.1.0]heptan-7-yl]methanamine |
| SMILES | Cc1cc([C@@]2(CN)[C@@H]3CCN(c4cnc5c(-c6ccc(C(F)F)c7ncccc67)[nH]nc5n4)C[C@@H]32)no1 |
| InChI | InChI=1S/C26H24F2N8O/c1-13-9-19(35-37-13)26(12-29)17-6-8-36(11-18(17)26)20-10-31-23-22(33-34-25(23)32-20)15-4-5-16(24(27)28)21-14(15)3-2-7-30-21/h2-5,7,9-10,17-18,24H,6,8,11-12,29H2,1H3,(H,32,33,34)/t17-,18+,26+/m1/s1 |
| InChIKey | OVOCXLPPQYWKIO-ZENTWMBTSA-N |
| XLogP | 4.15 |
| TPSA | 122.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |