C25H24F2N8O2 — CID 164850808
4-[6-[(1S,6R,7S)-7-(aminomethyl)-7-(5-methyl-1,2-oxazol-3-yl)-3-azabicyclo[4.1.0]heptan-3-yl]-2H-pyrazolo[3,4-b]pyrazin-3-yl]-3,3-difluoro-1-methylindol-2-one (PubChem CID 164850808) has the molecular formula C25H24F2N8O2 and a molecular weight of 506.52 g/mol. Its IUPAC name is 4-[6-[(1S,6R,7S)-7-(aminomethyl)-7-(5-methyl-1,2-oxazol-3-yl)-3-azabicyclo[4.1.0]heptan-3-yl]-2H-pyrazolo[3,4-b]pyrazin-3-yl]-3,3-difluoro-1-methylindol-2-one.
| Compound Name | 4-[6-[(1S,6R,7S)-7-(aminomethyl)-7-(5-methyl-1,2-oxazol-3-yl)-3-azabicyclo[4.1.0]heptan-3-yl]-2H-pyrazolo[3,4-b]pyrazin-3-yl]-3,3-difluoro-1-methylindol-2-one |
|---|---|
| PubChem CID | 164850808 |
| Molecular Formula | C25H24F2N8O2 |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 4-[6-[(1S,6R,7S)-7-(aminomethyl)-7-(5-methyl-1,2-oxazol-3-yl)-3-azabicyclo[4.1.0]heptan-3-yl]-2H-pyrazolo[3,4-b]pyrazin-3-yl]-3,3-difluoro-1-methylindol-2-one |
| SMILES | Cc1cc([C@@]2(CN)[C@@H]3CCN(c4cnc5c(-c6cccc7c6C(F)(F)C(=O)N7C)[nH]nc5n4)C[C@@H]32)no1 |
| InChI | InChI=1S/C25H24F2N8O2/c1-12-8-17(33-37-12)24(11-28)14-6-7-35(10-15(14)24)18-9-29-21-20(31-32-22(21)30-18)13-4-3-5-16-19(13)25(26,27)23(36)34(16)2/h3-5,8-9,14-15H,6-7,10-11,28H2,1-2H3,(H,30,31,32)/t14-,15+,24+/m1/s1 |
| InChIKey | QSLLSRDUFUNQIK-IYPVNNRCSA-N |
| XLogP | 2.74 |
| TPSA | 130.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |