C25H27N9O — CID 164850809
[(1S,6R,7S)-3-[3-(2,4-dimethylindazol-5-yl)-2H-pyrazolo[3,4-b]pyrazin-6-yl]-7-(5-methyl-1,2-oxazol-3-yl)-3-azabicyclo[4.1.0]heptan-7-yl]methanamine (PubChem CID 164850809) has the molecular formula C25H27N9O and a molecular weight of 469.55 g/mol. Its IUPAC name is [(1S,6R,7S)-3-[3-(2,4-dimethylindazol-5-yl)-2H-pyrazolo[3,4-b]pyrazin-6-yl]-7-(5-methyl-1,2-oxazol-3-yl)-3-azabicyclo[4.1.0]heptan-7-yl]methanamine.
| Compound Name | [(1S,6R,7S)-3-[3-(2,4-dimethylindazol-5-yl)-2H-pyrazolo[3,4-b]pyrazin-6-yl]-7-(5-methyl-1,2-oxazol-3-yl)-3-azabicyclo[4.1.0]heptan-7-yl]methanamine |
|---|---|
| PubChem CID | 164850809 |
| Molecular Formula | C25H27N9O |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | [(1S,6R,7S)-3-[3-(2,4-dimethylindazol-5-yl)-2H-pyrazolo[3,4-b]pyrazin-6-yl]-7-(5-methyl-1,2-oxazol-3-yl)-3-azabicyclo[4.1.0]heptan-7-yl]methanamine |
| SMILES | Cc1cc([C@@]2(CN)[C@@H]3CCN(c4cnc5c(-c6ccc7nn(C)cc7c6C)[nH]nc5n4)C[C@@H]32)no1 |
| InChI | InChI=1S/C25H27N9O/c1-13-8-20(32-35-13)25(12-26)17-6-7-34(11-18(17)25)21-9-27-23-22(29-30-24(23)28-21)15-4-5-19-16(14(15)2)10-33(3)31-19/h4-5,8-10,17-18H,6-7,11-12,26H2,1-3H3,(H,28,29,30)/t17-,18+,25+/m1/s1 |
| InChIKey | GHABPBJYMJAQQV-UZEJHQAJSA-N |
| XLogP | 2.86 |
| TPSA | 127.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |