C29H32IN7O3S — CID 164850926
benzyl N-[[(1S,6R,7S)-3-[3-iodo-1-(oxan-2-yl)pyrazolo[3,4-b]pyrazin-6-yl]-7-(4-methyl-1,3-thiazol-2-yl)-3-azabicyclo[4.1.0]heptan-7-yl]methyl]carbamate (PubChem CID 164850926) has the molecular formula C29H32IN7O3S and a molecular weight of 685.59 g/mol. Its IUPAC name is benzyl N-[[(1S,6R,7S)-3-[3-iodo-1-(oxan-2-yl)pyrazolo[3,4-b]pyrazin-6-yl]-7-(4-methyl-1,3-thiazol-2-yl)-3-azabicyclo[4.1.0]heptan-7-yl]methyl]carbamate.
| Compound Name | benzyl N-[[(1S,6R,7S)-3-[3-iodo-1-(oxan-2-yl)pyrazolo[3,4-b]pyrazin-6-yl]-7-(4-methyl-1,3-thiazol-2-yl)-3-azabicyclo[4.1.0]heptan-7-yl]methyl]carbamate |
|---|---|
| PubChem CID | 164850926 |
| Molecular Formula | C29H32IN7O3S |
| Molecular Weight | 685.59 g/mol |
| Exact Mass | 685.13 |
| IUPAC Name | benzyl N-[[(1S,6R,7S)-3-[3-iodo-1-(oxan-2-yl)pyrazolo[3,4-b]pyrazin-6-yl]-7-(4-methyl-1,3-thiazol-2-yl)-3-azabicyclo[4.1.0]heptan-7-yl]methyl]carbamate |
| SMILES | Cc1csc([C@@]2(CNC(=O)OCc3ccccc3)[C@@H]3CCN(c4cnc5c(I)nn(C6CCCCO6)c5n4)C[C@@H]32)n1 |
| InChI | InChI=1S/C29H32IN7O3S/c1-18-16-41-27(33-18)29(17-32-28(38)40-15-19-7-3-2-4-8-19)20-10-11-36(14-21(20)29)22-13-31-24-25(30)35-37(26(24)34-22)23-9-5-6-12-39-23/h2-4,7-8,13,16,20-21,23H,5-6,9-12,14-15,17H2,1H3,(H,32,38)/t20-,21+,23?,29+/m1/s1 |
| InChIKey | LXRIDWFOFOTYJB-XHFMEXEISA-N |
| XLogP | 5.22 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.59 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|