C30H45N11O11 — CID 164851488
spiro[1,4,7,10,13,16,19,22,26,29,32-undecazabicyclo[32.3.0]heptatriacontane-31,1'-cyclopentane]-2,5,8,11,14,17,20,23,27,30,33-undecone (PubChem CID 164851488) has the molecular formula C30H45N11O11 and a molecular weight of 735.76 g/mol. Its IUPAC name is spiro[1,4,7,10,13,16,19,22,26,29,32-undecazabicyclo[32.3.0]heptatriacontane-31,1'-cyclopentane]-2,5,8,11,14,17,20,23,27,30,33-undecone.
| Compound Name | spiro[1,4,7,10,13,16,19,22,26,29,32-undecazabicyclo[32.3.0]heptatriacontane-31,1'-cyclopentane]-2,5,8,11,14,17,20,23,27,30,33-undecone |
|---|---|
| PubChem CID | 164851488 |
| Molecular Formula | C30H45N11O11 |
| Molecular Weight | 735.76 g/mol |
| Exact Mass | 735.33 |
| IUPAC Name | spiro[1,4,7,10,13,16,19,22,26,29,32-undecazabicyclo[32.3.0]heptatriacontane-31,1'-cyclopentane]-2,5,8,11,14,17,20,23,27,30,33-undecone |
| SMILES | O=C1CCNC(=O)CNC(=O)C2(CCCC2)NC(=O)C2CCCN2C(=O)CNC(=O)CNC(=O)CNC(=O)CNC(=O)CNC(=O)CNC(=O)CN1 |
| InChI | InChI=1S/C30H45N11O11/c42-19-5-8-31-20(43)16-39-29(52)30(6-1-2-7-30)40-28(51)18-4-3-9-41(18)27(50)17-38-26(49)15-37-25(48)14-36-24(47)13-35-23(46)12-34-22(45)11-33-21(44)10-32-19/h18H,1-17H2,(H,31,43)(H,32,42)(H,33,44)(H,34,45)(H,35,46)(H,36,47)(H,37,48)(H,38,49)(H,39,52)(H,40,51) |
| InChIKey | GFJNIXUBQSTEIR-UHFFFAOYSA-N |
| XLogP | -7.14 |
| TPSA | 311.31 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.76 |
| LogP ≤ 5 | -7.14 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |