About 2-[3,6-bis(dimethylamino)-10,10-dimethyl-9H-anthracen-9-yl]benzoic acid
2-[3,6-bis(dimethylamino)-10,10-dimethyl-9H-anthracen-9-yl]benzoic acid (PubChem CID 164851886) has the molecular formula C27H30N2O2
and a molecular weight of 414.55 g/mol. Its IUPAC name is 2-[3,6-bis(dimethylamino)-10,10-dimethyl-9H-anthracen-9-yl]benzoic acid.
Molecular Properties
| Compound Name | 2-[3,6-bis(dimethylamino)-10,10-dimethyl-9H-anthracen-9-yl]benzoic acid |
| PubChem CID | 164851886 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 2-[3,6-bis(dimethylamino)-10,10-dimethyl-9H-anthracen-9-yl]benzoic acid |
| SMILES | CN(C)c1ccc2c(c1)C(C)(C)c1cc(N(C)C)ccc1C2c1ccccc1C(=O)O |
| InChI | InChI=1S/C27H30N2O2/c1-27(2)23-15-17(28(3)4)11-13-21(23)25(19-9-7-8-10-20(19)26(30)31)22-14-12-18(29(5)6)16-24(22)27/h7-16,25H,1-6H3,(H,30,31) |
| InChIKey | HBZRBIGSSFHECI-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,6-bis(dimethylamino)-10,10-dimethyl-9H-anthracen-9-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,6-bis(dimethylamino)-10,10-dimethyl-9H-anthracen-9-yl]benzoic acid?
The IUPAC name of 2-[3,6-bis(dimethylamino)-10,10-dimethyl-9H-anthracen-9-yl]benzoic acid (CID 164851886) is 2-[3,6-bis(dimethylamino)-10,10-dimethyl-9H-anthracen-9-yl]benzoic acid.
What is the SMILES notation for 2-[3,6-bis(dimethylamino)-10,10-dimethyl-9H-anthracen-9-yl]benzoic acid?
The canonical SMILES for 2-[3,6-bis(dimethylamino)-10,10-dimethyl-9H-anthracen-9-yl]benzoic acid is CN(C)c1ccc2c(c1)C(C)(C)c1cc(N(C)C)ccc1C2c1ccccc1C(=O)O.
What is the InChIKey of 2-[3,6-bis(dimethylamino)-10,10-dimethyl-9H-anthracen-9-yl]benzoic acid?
The InChIKey is HBZRBIGSSFHECI-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H30N2O2/c1-27(2)23-15-17(28(3)4)11-13-21(23)25(19-9-7-8-10-20(19)26(30)31)22-14-12-18(29(5)6)16-24(22)27/h7-16,25H,1-6H3,(H,30,31).
What are the key properties of 2-[3,6-bis(dimethylamino)-10,10-dimethyl-9H-anthracen-9-yl]benzoic acid?
2-[3,6-bis(dimethylamino)-10,10-dimethyl-9H-anthracen-9-yl]benzoic acid has a molecular weight of 414.55 g/mol, XLogP of 5.34, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,6-bis(dimethylamino)-10,10-dimethyl-9H-anthracen-9-yl]benzoic acid is sourced from PubChem (CID 164851886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).